Products 16271-33-3
CAS 16271-33-3 appears in our catalog under these names: 2,4-Dichlorobenzenesulfonyl chloride, 2,4–Dichlorobenzenesulfonyl chloride, 2,4-Dichlorobenzenesulfonyl Chloride, >98.0%(GC)(T), 2,4-Dichlorobenzenesulfonyl chloride 98%, 2,4-DICHLOROBENZENESULFONYL CHLORIDE,. Offered by: TargetMol, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 500g, 100g, 25 g, 100 g, 10 g.
2,4-dichlorobenzenesulfonyl chloride (CAS 16271-33-3) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,4-dichlorobenzenesulfonyl chloride. InChIKey: FDTPBIKNYWQLAE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3O2S |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2,4-dichlorobenzenesulfonyl chloride |
| InChIKey | FDTPBIKNYWQLAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dichlorobenzenesulfonyl chloride, Benzenesulfonyl chloride, 2,4-dichloro-, 4-11-00-00132 (Beilstein Handbook Reference), FDTPBIKNYWQLAE-UHFFFAOYSA-N, 2,4-Dichlorobenzene-1-Sulfonyl Chloride, 2,4-dichloro-benzenesulfonyl chloride, 2,4-dichlorobenzenesulphonyl chloride, 2,4-Dichlorobenzenesulfonylchloride, (2,4-dichlorophenyl)chlorosulfone, 2,4-dichlorophenylsulfonyl chloride