Products 5402-73-3

CAS 5402-73-3 appears in our catalog under these names: 2,5-Dichlorobenzenesulfonyl chloride, 97%, 2,5-Dichlorobenzenesulfonyl Chloride, 2,5-Dichlorobenzenesulfonyl Chloride, >98.0%(GC)(T), 2,5-DICHLOROBENZENESULFONYL CHLORIDE, 98. Offered by: Combi-blocks, Chemat Brand, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 500g, on request, 0,25g, 2,5g.

Structural formula: {0} (CAS {1})

2,5-dichlorobenzenesulfonyl chloride (CAS 5402-73-3) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,5-dichlorobenzenesulfonyl chloride. InChIKey: BXCOSWRSIISQSL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl3O2S
Molecular weight245.5 g/mol
IUPAC name2,5-dichlorobenzenesulfonyl chloride
InChIKeyBXCOSWRSIISQSL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)