CAS 5402-73-3 appears in our catalog under these names: 2,5-Dichlorobenzenesulfonyl chloride, 97%, 2,5-Dichlorobenzenesulfonyl Chloride, 2,5-Dichlorobenzenesulfonyl Chloride, >98.0%(GC)(T), 2,5-DICHLOROBENZENESULFONYL CHLORIDE, 98. Offered by: Combi-blocks, Chemat Brand, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 500g, on request, 0,25g, 2,5g.
2,5-dichlorobenzenesulfonyl chloride (CAS 5402-73-3) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,5-dichlorobenzenesulfonyl chloride. InChIKey: BXCOSWRSIISQSL-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3O2S |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2,5-dichlorobenzenesulfonyl chloride |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)