cas: 58584-83-1 — see every product listed under this CAS number, including other names
2,6-Dichloronicotinoyl chloride 95% (CAS 58584-83-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120676-250mg |
| cas | 58584-83-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 2845.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120676 |
2,6-dichloropyridine-3-carbonyl chloride (CAS 58584-83-1) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 2,6-dichloropyridine-3-carbonyl chloride. InChIKey: JHMHYTKDALCQSZ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 2,6-dichloropyridine-3-carbonyl chloride |
| InChIKey | JHMHYTKDALCQSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)