Products 1325559-23-6
CAS 1325559-23-6 is the registry number for 2,3-Dichloroisonicotinoyl chloride, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2,3-dichloropyridine-4-carbonyl chloride (CAS 1325559-23-6) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 2,3-dichloropyridine-4-carbonyl chloride. InChIKey: JWLTWCYNFFQELG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 2,3-dichloropyridine-4-carbonyl chloride |
| InChIKey | JWLTWCYNFFQELG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)