CAS 58584-83-1 appears in our catalog under these names: 2,6-Dichloropyridine-3-carbonyl chloride, 96%, 2,6-Dichloronicotinyl Chloride, 2,6-Dichloronicotinoyl chloride 95%. Offered by: Combi-blocks, TRC, Ambeed. Available pack sizes: 5g, 1g, 500mg, 250mg, 10g, 25g.
2,6-dichloropyridine-3-carbonyl chloride (CAS 58584-83-1) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 2,6-dichloropyridine-3-carbonyl chloride. InChIKey: JHMHYTKDALCQSZ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 2,6-dichloropyridine-3-carbonyl chloride |
| InChIKey | JHMHYTKDALCQSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)