Products 70151-22-3
CAS 70151-22-3 is the registry number for 3,5-Dichloropyridine-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,5-dichloropyridine-2-carbonyl chloride (CAS 70151-22-3) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 3,5-dichloropyridine-2-carbonyl chloride. InChIKey: RTSBEPIQHLPRCX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 3,5-dichloropyridine-2-carbonyl chloride |
| InChIKey | RTSBEPIQHLPRCX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(=O)Cl)Cl |
Computed by PubChem (NCBI)