CAS 78686-87-0 appears in our catalog under these names: 2,5-Dichloropyridine-3-carbonyl chloride, 95%, 2,5-Dichloropyridine-3-carbonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g, 10g.
2,5-dichloropyridine-3-carbonyl chloride (CAS 78686-87-0) is a chemical compound with the molecular formula C6H2Cl3NO and a molecular weight of 210.4 g/mol. IUPAC name: 2,5-dichloropyridine-3-carbonyl chloride. InChIKey: VRJMAKCJTSZUQR-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO |
|---|---|
| Molecular weight | 210.4 g/mol |
| IUPAC name | 2,5-dichloropyridine-3-carbonyl chloride |
| InChIKey | VRJMAKCJTSZUQR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)