2,6-Dichloropurine, 98%
cas: 5451-40-1 — see every product listed under this CAS number, including other names
2,6-Dichloropurine, 98% (CAS 5451-40-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A101242-5g |
| cas | 5451-40-1 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 448.25 Pln | |
| Ambeed | 500g | 1972.38 Pln | |
| Ambeed | 1kg | 3863.62 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 208.84 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 530.95 Pln | |
| BLDpharm | 500g | 2302.55 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dichloro-7H-purine (CAS 5451-40-1) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,6-dichloro-7H-purine. InChIKey: RMFWVOLULURGJI-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,6-dichloro-7H-purine |
| InChIKey | RMFWVOLULURGJI-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)