cas: 5451-40-1 — see every product listed under this CAS number, including other names
2,6-Dichloropurine, 99.95% (CAS 5451-40-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 250 g, 10 g, 25 g, 1 g, 50 g, 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007367-5 g |
| cas | 5451-40-1 |
| size | 5 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 250 g | 3356.87 Pln | |
| MedChemExpress | 10 g | 477.59 Pln | |
| MedChemExpress | 25 g | 839.82 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 50 g | 1197.41 Pln | |
| MedChemExpress | 500 g | 4963.69 Pln | |
| MedChemExpress | 100 g | 1736.11 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
2,6-dichloro-7H-purine (CAS 5451-40-1) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,6-dichloro-7H-purine. InChIKey: RMFWVOLULURGJI-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,6-dichloro-7H-purine |
| InChIKey | RMFWVOLULURGJI-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)