CAS 5451-40-1 appears in our catalog under these names: 2,6-Dichloropurine, 2,6–Dichloropurine, 2,6-Dichloropurine/ 98+%, 2,6-Dichloropurine, 97% , 2,6-Dichloropurine, >97.0%(HPLC)(T). Offered by: TRC, Mikromol, GLPBio, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 500mg, 25mg, 100g, 25g, 5g, 1g, 0,25kg, 0,1kg.
2,6-dichloro-7H-purine (CAS 5451-40-1) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,6-dichloro-7H-purine. InChIKey: RMFWVOLULURGJI-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,6-dichloro-7H-purine |
| InChIKey | RMFWVOLULURGJI-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)