2,6-Dichloropyridine-4-sulfonyl chloride, 95%
cas: 1058741-91-5 — see every product listed under this CAS number, including other names
2,6-Dichloropyridine-4-sulfonyl chloride, 95% (CAS 1058741-91-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F626974-100MG |
| cas | 1058741-91-5 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 804.94 Pln | |
| Fluorochem | 1g | 2018.06 Pln | |
| Fluorochem | 5g | 5272.12 Pln | |
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 1961.25 Pln | |
| Ambeed | 5g | 5165.25 Pln | |
| Ambeed | 10g | 8274.69 Pln | |
| BLDpharm | 100mg | 503.18 Pln | |
| BLDpharm | 250mg | 847.50 Pln | |
| BLDpharm | 1g | 2108.17 Pln | |
| BLDpharm | 5g | 5562.51 Pln | |
| BLDpharm | 10g | 8911.33 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2,6-dichloropyridine-4-sulfonyl chloride (CAS 1058741-91-5) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 2,6-dichloropyridine-4-sulfonyl chloride. InChIKey: VUNOBXYWTQDDIR-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 2,6-dichloropyridine-4-sulfonyl chloride |
| InChIKey | VUNOBXYWTQDDIR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichloro-4-pyridinesulfonyl chloride