CAS 98121-40-5 appears in our catalog under these names: 5,6-Dichloropyridine-3-sulfonyl chloride, 95%, 5,6-Dichloropyridine-3-sulfonyl chloride 98%, 5,6-Dichloropyridine-3-sulfonyl chloride, 98%, 98%, 5,6-Dichloropyridine-3-sulfonyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
5,6-dichloropyridine-3-sulfonyl chloride (CAS 98121-40-5) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 5,6-dichloropyridine-3-sulfonyl chloride. InChIKey: AXIWIKRWIWIPGT-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 5,6-dichloropyridine-3-sulfonyl chloride |
| InChIKey | AXIWIKRWIWIPGT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)