Products 98121-40-5

CAS 98121-40-5 appears in our catalog under these names: 5,6-Dichloropyridine-3-sulfonyl chloride, 95%, 5,6-Dichloropyridine-3-sulfonyl chloride 98%, 5,6-Dichloropyridine-3-sulfonyl chloride, 98%, 98%, 5,6-Dichloropyridine-3-sulfonyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.

Structural formula: {0} (CAS {1})

5,6-dichloropyridine-3-sulfonyl chloride (CAS 98121-40-5) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 5,6-dichloropyridine-3-sulfonyl chloride. InChIKey: AXIWIKRWIWIPGT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl3NO2S
Molecular weight246.5 g/mol
IUPAC name5,6-dichloropyridine-3-sulfonyl chloride
InChIKeyAXIWIKRWIWIPGT-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)