Products 733047-84-2

CAS 733047-84-2 appears in our catalog under these names: 2,4-Dichloropyridine-3-sulfonyl chloride, 95%, 2,4-Dichloropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,4-dichloropyridine-3-sulfonyl chloride (CAS 733047-84-2) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 2,4-dichloropyridine-3-sulfonyl chloride. InChIKey: YGYLCSUIGQQRBL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl3NO2S
Molecular weight246.5 g/mol
IUPAC name2,4-dichloropyridine-3-sulfonyl chloride
InChIKeyYGYLCSUIGQQRBL-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)