CAS 733047-84-2 appears in our catalog under these names: 2,4-Dichloropyridine-3-sulfonyl chloride, 95%, 2,4-Dichloropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dichloropyridine-3-sulfonyl chloride (CAS 733047-84-2) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 2,4-dichloropyridine-3-sulfonyl chloride. InChIKey: YGYLCSUIGQQRBL-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 2,4-dichloropyridine-3-sulfonyl chloride |
| InChIKey | YGYLCSUIGQQRBL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)