CAS 1352498-23-7 appears in our catalog under these names: 4,5-Dichloropyridine-3-sulfonyl chloride, 95%, 4,5-Dichloropyridine-3-sulfonyl chloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4,5-dichloropyridine-3-sulfonyl chloride (CAS 1352498-23-7) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 4,5-dichloropyridine-3-sulfonyl chloride. InChIKey: RKXHGORYRFDXNN-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 4,5-dichloropyridine-3-sulfonyl chloride |
| InChIKey | RKXHGORYRFDXNN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)