CAS 1402666-75-4 appears in our catalog under these names: 4,6-Dichloropyridine-3-sulfonyl chloride, 95%, 4,6-Dichloropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,6-dichloropyridine-3-sulfonyl chloride (CAS 1402666-75-4) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 4,6-dichloropyridine-3-sulfonyl chloride. InChIKey: GJXYLMHEGDMQIS-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 4,6-dichloropyridine-3-sulfonyl chloride |
| InChIKey | GJXYLMHEGDMQIS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)