cas: 2484888-92-6 — see every product listed under this CAS number, including other names
2,6-Difluoro-3-propoxybenzaldehyde, 98% (CAS 2484888-92-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1655811-10g |
| cas | 2484888-92-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 22750.84 Pln | |
| AmBeed | 5g | 13441.54 Pln | |
| AmBeed | 25g | 44585.38 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-difluoro-3-propoxybenzaldehyde (CAS 2484888-92-6) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2,6-difluoro-3-propoxybenzaldehyde. InChIKey: MRRSOMIRRZQVMR-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2,6-difluoro-3-propoxybenzaldehyde |
| InChIKey | MRRSOMIRRZQVMR-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C(=C(C=C1)F)C=O)F |
Computed by PubChem (NCBI)