Products 214917-68-7
CAS 214917-68-7 appears in our catalog under these names: 2,6–Difluoro–4–hydroxybenzoic acid, 2,6-Difluoro-4-hydroxybenzoic acid, 95% , 2,6-Difluoro-4-hydroxybenzoic Acid, >98.0%(GC), 2,6-Difluoro-4-hydroxybenzoic acid 95%, 2,6-Difluoro-4-hydroxybenzoic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
2,6-difluoro-4-hydroxybenzoic acid (CAS 214917-68-7) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,6-difluoro-4-hydroxybenzoic acid. InChIKey: NFIQGYBXSJQLSR-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,6-difluoro-4-hydroxybenzoic acid |
| InChIKey | NFIQGYBXSJQLSR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)O |
Computed by PubChem (NCBI)