cas: 1394944-82-1 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-isopropoxybenzoic acid methyl ester (CAS 1394944-82-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631560-1G |
| cas | 1394944-82-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4324.54 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,6-difluoro-4-propan-2-yloxybenzoate (CAS 1394944-82-1) is a chemical compound with the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. IUPAC name: methyl 2,6-difluoro-4-propan-2-yloxybenzoate. InChIKey: HZQOAZRATOOSEQ-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O3 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-propan-2-yloxybenzoate |
| InChIKey | HZQOAZRATOOSEQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)