CAS 1252900-83-6 is the registry number for tert-Butyl 3,5-difluoro-4-hydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 3,5-difluoro-4-hydroxybenzoate (CAS 1252900-83-6) is a chemical compound with the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. IUPAC name: tert-butyl 3,5-difluoro-4-hydroxybenzoate. InChIKey: UWUQGGSTEIXQSX-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O3 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | tert-butyl 3,5-difluoro-4-hydroxybenzoate |
| InChIKey | UWUQGGSTEIXQSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C(=C1)F)O)F |
Computed by PubChem (NCBI)