Products 2504203-50-1
CAS 2504203-50-1 appears in our catalog under these names: Methyl 2,3-difluoro-4-isopropoxybenzoate, 95%, Methyl 2,3-difluoro-4-isopropoxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 2,3-difluoro-4-propan-2-yloxybenzoate (CAS 2504203-50-1) is a chemical compound with the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. IUPAC name: methyl 2,3-difluoro-4-propan-2-yloxybenzoate. InChIKey: ZDEIJKACQIGWSO-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O3 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-propan-2-yloxybenzoate |
| InChIKey | ZDEIJKACQIGWSO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)C(=O)OC)F)F |
Computed by PubChem (NCBI)