CAS 1394944-82-1 appears in our catalog under these names: 2,6-Difluoro-4-isopropoxybenzoic acid methyl ester, 95%, 2,6-Difluoro-4-isopropoxybenzoic acid methyl ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
Methyl 2,6-difluoro-4-propan-2-yloxybenzoate (CAS 1394944-82-1) is a chemical compound with the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. IUPAC name: methyl 2,6-difluoro-4-propan-2-yloxybenzoate. InChIKey: HZQOAZRATOOSEQ-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O3 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-propan-2-yloxybenzoate |
| InChIKey | HZQOAZRATOOSEQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)