Products 2586125-76-8

CAS 2586125-76-8 is the registry number for Ethyl 2,3-difluoro-5-methoxy-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2,3-difluoro-5-methoxy-4-methylbenzoate (CAS 2586125-76-8) is a chemical compound with the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. IUPAC name: ethyl 2,3-difluoro-5-methoxy-4-methylbenzoate. InChIKey: OZNFBODWFCCBDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12F2O3
Molecular weight230.21 g/mol
IUPAC nameethyl 2,3-difluoro-5-methoxy-4-methylbenzoate
InChIKeyOZNFBODWFCCBDJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C(=C1F)F)C)OC

Computed by PubChem (NCBI)