2,6-Difluoro-4-nitrobenzene-1-sulfonyl chloride, 95%
cas: 1193388-31-6 — see every product listed under this CAS number, including other names
2,6-Difluoro-4-nitrobenzene-1-sulfonyl chloride, 95% (CAS 1193388-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A871826-250mg |
| cas | 1193388-31-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1633.06 Pln | |
| Ambeed | 5g | 6316.69 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1206.80 Pln | |
| Chemat | 5g | 4643.60 Pln | |
| BLDpharm | 100mg | 436.54 Pln | |
| BLDpharm | 250mg | 619.81 Pln | |
| BLDpharm | 1g | 1597.24 Pln | |
| BLDpharm | 5g | 6184.51 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,6-difluoro-4-nitrobenzenesulfonyl chloride (CAS 1193388-31-6) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 2,6-difluoro-4-nitrobenzenesulfonyl chloride. InChIKey: XMTMCDJHARJFGE-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO4S |
|---|---|
| Molecular weight | 257.60 g/mol |
| IUPAC name | 2,6-difluoro-4-nitrobenzenesulfonyl chloride |
| InChIKey | XMTMCDJHARJFGE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)