cas: 117338-43-9 — see every product listed under this CAS number, including other names
2,6-Difluorocinnamaldehyde 97% (CAS 117338-43-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A698788-100mg |
| cas | 117338-43-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 882.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A698788 |
(E)-3-(2,6-difluorophenyl)prop-2-enal (CAS 117338-43-9) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: (E)-3-(2,6-difluorophenyl)prop-2-enal. InChIKey: ABQCTYYKKNJKPK-NSCUHMNNSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | (E)-3-(2,6-difluorophenyl)prop-2-enal |
| InChIKey | ABQCTYYKKNJKPK-NSCUHMNNSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=C/C=O)F |
Computed by PubChem (NCBI)