cas: 117338-43-9 — see every product listed under this CAS number, including other names
2,6-Difluorocinnamic aldehyde, 97%, 97% (CAS 117338-43-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E6V-100mg |
| cas | 117338-43-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 1826.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(2,6-difluorophenyl)prop-2-enal (CAS 117338-43-9) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: (E)-3-(2,6-difluorophenyl)prop-2-enal. InChIKey: ABQCTYYKKNJKPK-NSCUHMNNSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | (E)-3-(2,6-difluorophenyl)prop-2-enal |
| InChIKey | ABQCTYYKKNJKPK-NSCUHMNNSA-N |
| SMILES | C1=CC(=C(C(=C1)F)/C=C/C=O)F |
Computed by PubChem (NCBI)