Products 130408-16-1
CAS 130408-16-1 appears in our catalog under these names: 4,7-Difluoroindan-1-one 95%, 4,7-Difluoroindan-1-one, 98%, 4，7-Difluoroindan-1-one, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
4,7-difluoro-2,3-dihydroinden-1-one (CAS 130408-16-1) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 4,7-difluoro-2,3-dihydroinden-1-one. InChIKey: KMWBFTTYYGUTNW-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 4,7-difluoro-2,3-dihydroinden-1-one |
| InChIKey | KMWBFTTYYGUTNW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)F)F |
Computed by PubChem (NCBI)