cas: 949034-65-5 — see every product listed under this CAS number, including other names
2,6-Dihydro-4H-thieno(3,4-c)pyrazole-3-carboxylic acid 5,5-dioxide, 95% (CAS 949034-65-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1181358-1g |
| cas | 949034-65-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 26305.30 Pln | |
| AmBeed | 250mg | 7771.33 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,5-dioxo-4,6-dihydro-1H-thieno[3,4-d]pyrazole-3-carboxylic acid (CAS 949034-65-5) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 5,5-dioxo-4,6-dihydro-1H-thieno[3,4-d]pyrazole-3-carboxylic acid. InChIKey: WOCPXJNFAGSZGW-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 5,5-dioxo-4,6-dihydro-1H-thieno[3,4-d]pyrazole-3-carboxylic acid |
| InChIKey | WOCPXJNFAGSZGW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)NN=C2C(=O)O |
Computed by PubChem (NCBI)