CAS 1211532-32-9 is the registry number for 4-(Methylsulfonyl)pyrimidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methylsulfonylpyrimidine-2-carboxylic acid (CAS 1211532-32-9) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 4-methylsulfonylpyrimidine-2-carboxylic acid. InChIKey: XROCNQZOFWALAU-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 4-methylsulfonylpyrimidine-2-carboxylic acid |
| InChIKey | XROCNQZOFWALAU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC(=NC=C1)C(=O)O |
Computed by PubChem (NCBI)