CAS 949034-65-5 appears in our catalog under these names: 4,6-Dihydro-2h-thieno[3,4-c]pyrazole-3-carboxylic acid 5,5-dioxide, 95%, 2,6-Dihydro-4H-thieno(3,4-c)pyrazole-3-carboxylic acid 5,5-dioxide, 95%, 4,6–dihydro–2H–thieno(3,4–c)pyrazole–3–carboxylic acid 5,5–dioxide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
5,5-dioxo-4,6-dihydro-1H-thieno[3,4-d]pyrazole-3-carboxylic acid (CAS 949034-65-5) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 5,5-dioxo-4,6-dihydro-1H-thieno[3,4-d]pyrazole-3-carboxylic acid. InChIKey: WOCPXJNFAGSZGW-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 5,5-dioxo-4,6-dihydro-1H-thieno[3,4-d]pyrazole-3-carboxylic acid |
| InChIKey | WOCPXJNFAGSZGW-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)NN=C2C(=O)O |
Computed by PubChem (NCBI)