Products 2044702-40-9

CAS 2044702-40-9 is the registry number for Ethyl 5-nitro-1,3-thiazole-4-carboxylate, 70%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 5-nitro-1,3-thiazole-4-carboxylate (CAS 2044702-40-9) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: ethyl 5-nitro-1,3-thiazole-4-carboxylate. InChIKey: YBTVCTRQXZTMOH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O4S
Molecular weight202.19 g/mol
IUPAC nameethyl 5-nitro-1,3-thiazole-4-carboxylate
InChIKeyYBTVCTRQXZTMOH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC=N1)[N+](=O)[O-]

Computed by PubChem (NCBI)