CAS 2044702-40-9 is the registry number for Ethyl 5-nitro-1,3-thiazole-4-carboxylate, 70%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 5-nitro-1,3-thiazole-4-carboxylate (CAS 2044702-40-9) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: ethyl 5-nitro-1,3-thiazole-4-carboxylate. InChIKey: YBTVCTRQXZTMOH-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | ethyl 5-nitro-1,3-thiazole-4-carboxylate |
| InChIKey | YBTVCTRQXZTMOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)