CAS 35196-10-2 is the registry number for 5-(Methylsulfonyl)-2-nitropyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
5-methylsulfonyl-2-nitropyridine (CAS 35196-10-2) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 5-methylsulfonyl-2-nitropyridine. InChIKey: IITUTZAGIVPTQC-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 5-methylsulfonyl-2-nitropyridine |
| InChIKey | IITUTZAGIVPTQC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)