cas: 1004761-68-5 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 95% (CAS 1004761-68-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A690739-100mg |
| cas | 1004761-68-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1249.25 Pln | |
| Ambeed | 25g | 4197.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A690739 |
2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1004761-68-5) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: SBYDVNRAKVMVMG-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | SBYDVNRAKVMVMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)