cas: 306296-76-4 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-formyl-benzoic acid (CAS 306296-76-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633171-1G |
| cas | 306296-76-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2575.15 Pln |
| delivery time | 3-4 weeks |
|---|
4-formyl-2,6-dimethylbenzoic acid (CAS 306296-76-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-formyl-2,6-dimethylbenzoic acid. InChIKey: IZLUAIAAIWYAHL-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-formyl-2,6-dimethylbenzoic acid |
| InChIKey | IZLUAIAAIWYAHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)C=O |
Computed by PubChem (NCBI)