cas: 306296-76-4 — see every product listed under this CAS number, including other names
4-Formyl-2,6-dimethylbenzoic acid 97% (CAS 306296-76-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A880416-250mg |
| cas | 306296-76-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1644.19 Pln | |
| Ambeed | 5g | 5588.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A880416 |
4-formyl-2,6-dimethylbenzoic acid (CAS 306296-76-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-formyl-2,6-dimethylbenzoic acid. InChIKey: IZLUAIAAIWYAHL-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-formyl-2,6-dimethylbenzoic acid |
| InChIKey | IZLUAIAAIWYAHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)C=O |
Computed by PubChem (NCBI)