cas: 2423-71-4 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-nitrophenol, 98%, 98% (CAS 2423-71-4) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G6I-50g |
| cas | 2423-71-4 |
| size | 50g |
| availability | 920g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 261.20 Pln | |
| Chemat | 250g | 1048.40 Pln | |
| Chemat | 500g | 2107.20 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 458.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethyl-4-nitrophenol (CAS 2423-71-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-4-nitrophenol. InChIKey: FNORUNUDZNWQFF-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-4-nitrophenol |
| InChIKey | FNORUNUDZNWQFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)