cas: 81438-52-0 — see every product listed under this CAS number, including other names
2,6-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid, 98% (CAS 81438-52-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F311526-250MG |
| cas | 81438-52-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1049.65 Pln | |
| Fluorochem | 5g | 5032.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid (CAS 81438-52-0) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2,6-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid. InChIKey: JCDXLERYTZDKRT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2,6-dimethylimidazo[1,2-a]pyridine-3-carboxylic acid |
| InChIKey | JCDXLERYTZDKRT-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=C2C(=O)O)C)C=C1 |
Computed by PubChem (NCBI)