Products 1417301-86-0

CAS 1417301-86-0 appears in our catalog under these names: 2,8-Diazaspiro[4.5]decan-3-one dihydrochloride, 95%, 2,8–diazaspiro(4·5)decan–3–one dihydrochloride, 2,8-Diazaspiro[4.5]decan-3-one dihydrochloride, 97%, 97%, 2,8-diazaspiro[4.5]decan-3-one dihydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100g.

Structural formula: {0} (CAS {1})

2,8-diazaspiro[4.5]decan-3-one;dihydrochloride (CAS 1417301-86-0) is a chemical compound with the molecular formula C8H16Cl2N2O and a molecular weight of 227.13 g/mol. IUPAC name: 2,8-diazaspiro[4.5]decan-3-one;dihydrochloride. InChIKey: PUGNXFYCUYCIAW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16Cl2N2O
Molecular weight227.13 g/mol
IUPAC name2,8-diazaspiro[4.5]decan-3-one;dihydrochloride
InChIKeyPUGNXFYCUYCIAW-UHFFFAOYSA-N
SMILESC1CNCCC12CC(=O)NC2.Cl.Cl

Computed by PubChem (NCBI)