CAS 1241620-77-8 is the registry number for 3-oxa-7,10-diazatricyclo[3.3.3.0,1,5]undecane dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-oxa-7,10-diazatricyclo[3.3.3.01,5]undecane;dihydrochloride (CAS 1241620-77-8) is a chemical compound with the molecular formula C8H16Cl2N2O and a molecular weight of 227.13 g/mol. IUPAC name: 3-oxa-7,10-diazatricyclo[3.3.3.01,5]undecane;dihydrochloride. InChIKey: UDFNKEIZUVVOAM-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2O |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 3-oxa-7,10-diazatricyclo[3.3.3.01,5]undecane;dihydrochloride |
| InChIKey | UDFNKEIZUVVOAM-UHFFFAOYSA-N |
| SMILES | C1C23CNCC2(CN1)COC3.Cl.Cl |
Computed by PubChem (NCBI)