CAS 1803572-34-0 is the registry number for (2-Amino-2-(furan-2-yl)ethyl)dimethylamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(furan-2-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride (CAS 1803572-34-0) is a chemical compound with the molecular formula C8H16Cl2N2O and a molecular weight of 227.13 g/mol. IUPAC name: 1-(furan-2-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride. InChIKey: NOKQLDXPCKGGKR-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2O |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 1-(furan-2-yl)-N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| InChIKey | NOKQLDXPCKGGKR-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC=CO1)N.Cl.Cl |
Computed by PubChem (NCBI)