CAS 25161-92-6 appears in our catalog under these names: Loline DiHCl, (+)-Loline Dihydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(1R,3S,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine;dihydrochloride (CAS 25161-92-6) is a chemical compound with the molecular formula C8H16Cl2N2O and a molecular weight of 227.13 g/mol. IUPAC name: (1R,3S,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine;dihydrochloride. InChIKey: KXMCKXCWMVJECG-PZJCLCORSA-N.
| Molecular formula | C8H16Cl2N2O |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | (1R,3S,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine;dihydrochloride |
| InChIKey | KXMCKXCWMVJECG-PZJCLCORSA-N |
| SMILES | CN[C@H]1[C@H]2CN3[C@@H]1[C@@H](O2)CC3.Cl.Cl |
Computed by PubChem (NCBI)