CAS 2416233-67-3 is the registry number for 1-(2,6-Diazaspiro[3.4]octan-2-yl)ethan-1-one dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,7-diazaspiro[3.4]octan-2-yl)ethanone;dihydrochloride (CAS 2416233-67-3) is a chemical compound with the molecular formula C8H16Cl2N2O and a molecular weight of 227.13 g/mol. IUPAC name: 1-(2,7-diazaspiro[3.4]octan-2-yl)ethanone;dihydrochloride. InChIKey: HMBOHNDQBXEYQK-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2O |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 1-(2,7-diazaspiro[3.4]octan-2-yl)ethanone;dihydrochloride |
| InChIKey | HMBOHNDQBXEYQK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2(C1)CCNC2.Cl.Cl |
Computed by PubChem (NCBI)