cas: 529-81-7 — see every product listed under this CAS number, including other names
2,8-Dimethyl-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine, 98%,RG, 98%,RG (CAS 529-81-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114V08-250mg |
| cas | 529-81-7 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 645.20 Pln |
| purity | 98%,RG |
|---|---|
| delivery time | 3 weeks |
5,13-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (CAS 529-81-7) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. IUPAC name: 5,13-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene. InChIKey: SXPSZIHEWFTLEQ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | 5,13-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| InChIKey | SXPSZIHEWFTLEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N3CC4=C(C=CC(=C4)C)N(C2)C3 |
Computed by PubChem (NCBI)