Products 2702970-58-7
CAS 2702970-58-7 is the registry number for 2,2'-((3,5-Dimethylphenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,5-dimethylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 2702970-58-7) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. IUPAC name: 2-[(3,5-dimethylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: LXIQOXVKFJHEOJ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | 2-[(3,5-dimethylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | LXIQOXVKFJHEOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C2=CC=CN2)C3=CC=CN3)C |
Computed by PubChem (NCBI)