CAS 21451-74-1 is the registry number for (5S,11S)-2,8-Dimethyl-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,13-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (CAS 21451-74-1) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. IUPAC name: 5,13-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene. InChIKey: SXPSZIHEWFTLEQ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | 5,13-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| InChIKey | SXPSZIHEWFTLEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N3CC4=C(C=CC(=C4)C)N(C2)C3 |
Computed by PubChem (NCBI)