CAS 141211-39-4 appears in our catalog under these names: 5,6-Dimethyl-1-(4-methylbenzyl)-1h-benzimidazole, 95%, 5,6-Dimethyl-1-(4-methylbenzyl)-1H-benzo(d)imidazole, 95%, 5,6-Dimethyl-1-(4-methylbenzyl)-1H-benzo[d]imidazole 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
5,6-dimethyl-1-[(4-methylphenyl)methyl]benzimidazole (CAS 141211-39-4) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. IUPAC name: 5,6-dimethyl-1-[(4-methylphenyl)methyl]benzimidazole. InChIKey: PRIOFQYYSHATGH-UHFFFAOYSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | 5,6-dimethyl-1-[(4-methylphenyl)methyl]benzimidazole |
| InChIKey | PRIOFQYYSHATGH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C=NC3=C2C=C(C(=C3)C)C |
Computed by PubChem (NCBI)