Products 2410443-42-2
CAS 2410443-42-2 appears in our catalog under these names: ZLN005-d4 (on Benzimidazole Ring), ZLN005–d4, ZLN005-d4, 99%, 99%, ZLN005-d4, 99.52%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 1mg, 10 mg, 5 mg, 1 mg.
2-(4-tert-butylphenyl)-4,5,6,7-tetradeuterio-1H-benzimidazole (CAS 2410443-42-2) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 254.36 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-4,5,6,7-tetradeuterio-1H-benzimidazole. InChIKey: LQUNNCQSFFKSSK-UGWFXTGHSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 254.36 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-4,5,6,7-tetradeuterio-1H-benzimidazole |
| InChIKey | LQUNNCQSFFKSSK-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC(=N2)C3=CC=C(C=C3)C(C)(C)C)[2H])[2H] |
Computed by PubChem (NCBI)