cas: 85575-93-5 — see every product listed under this CAS number, including other names
2,9-Dibutyl-1,10-phenanthroline, >98.0%(N) (CAS 85575-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2565-100MG |
| cas | 85575-93-5 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 241.28 Pln | |
| TCI | 1g | 1401.75 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(N) |
2,9-dibutyl-1,10-phenanthroline (CAS 85575-93-5) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 2,9-dibutyl-1,10-phenanthroline. InChIKey: LSGGPELKXXFMGO-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2,9-dibutyl-1,10-phenanthroline |
| InChIKey | LSGGPELKXXFMGO-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(C=CC3=C2N=C(C=C3)CCCC)C=C1 |
Computed by PubChem (NCBI)