2,9-Dibutyl-1,10-phenanthroline, 98%
cas: 85575-93-5 — see every product listed under this CAS number, including other names
2,9-Dibutyl-1,10-phenanthroline, 98% (CAS 85575-93-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QG-1411-250mg |
| cas | 85575-93-5 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 2465.82 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| Ambeed | 5g | 2473.00 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1394.00 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 586.48 Pln | |
| BLDpharm | 5g | 2657.98 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,9-dibutyl-1,10-phenanthroline (CAS 85575-93-5) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 2,9-dibutyl-1,10-phenanthroline. InChIKey: LSGGPELKXXFMGO-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2,9-dibutyl-1,10-phenanthroline |
| InChIKey | LSGGPELKXXFMGO-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(C=CC3=C2N=C(C=C3)CCCC)C=C1 |
Computed by PubChem (NCBI)