2,9-Dimethyl-5-nitro-1,10-phenanthroline, 97%
cas: 118752-27-5 — see every product listed under this CAS number, including other names
2,9-Dimethyl-5-nitro-1,10-phenanthroline, 97% (CAS 118752-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A731902-100mg |
| cas | 118752-27-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 893.25 Pln | |
| Ambeed | 1g | 2289.44 Pln | |
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 702.80 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 719.77 Pln | |
| BLDpharm | 1g | 1813.83 Pln | |
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 3293.65 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,9-dimethyl-5-nitro-1,10-phenanthroline (CAS 118752-27-5) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 2,9-dimethyl-5-nitro-1,10-phenanthroline. InChIKey: ZZKNDQYPXPYVNS-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 2,9-dimethyl-5-nitro-1,10-phenanthroline |
| InChIKey | ZZKNDQYPXPYVNS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C3C(=C(C=C2C=C1)[N+](=O)[O-])C=CC(=N3)C |
Computed by PubChem (NCBI)