Products 13406-77-4
CAS 13406-77-4 appears in our catalog under these names: 5-Amino-2-(4-aminophenyl)-1h-isoindole-1,3(2h)-dione, 95%, 5-Amino-2-(4-aminophenyl)isoindoline-1,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-amino-2-(4-aminophenyl)isoindole-1,3-dione (CAS 13406-77-4) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 5-amino-2-(4-aminophenyl)isoindole-1,3-dione. InChIKey: TUXYWZQZGJNBTQ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 5-amino-2-(4-aminophenyl)isoindole-1,3-dione |
| InChIKey | TUXYWZQZGJNBTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C(=O)C3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)